C23H26N2O5 — CID 11825743
(6S)-1,4-bis[(4-methoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,3,5-trione (PubChem CID 11825743) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is (6S)-1,4-bis[(4-methoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,3,5-trione.
| Compound Name | (6S)-1,4-bis[(4-methoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,3,5-trione |
|---|---|
| PubChem CID | 11825743 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | (6S)-1,4-bis[(4-methoxyphenyl)methyl]-6-propan-2-ylpiperazine-2,3,5-trione |
| SMILES | COc1ccc(CN2C(=O)C(=O)N(Cc3ccc(OC)cc3)[C@@H](C(C)C)C2=O)cc1 |
| InChI | InChI=1S/C23H26N2O5/c1-15(2)20-21(26)25(14-17-7-11-19(30-4)12-8-17)23(28)22(27)24(20)13-16-5-9-18(29-3)10-6-16/h5-12,15,20H,13-14H2,1-4H3/t20-/m0/s1 |
| InChIKey | JCRABTZHDZZQKD-FQEVSTJZSA-N |
| XLogP | 2.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|