C14H22INO5 — CID 11825762
2-[[(3aS,4R,7aR)-5-iodo-2,2,7a-trimethyl-4,7-dihydro-3aH-1,3-benzodioxol-4-yl]oxy]-N-methoxy-N-methylacetamide (PubChem CID 11825762) has the molecular formula C14H22INO5 and a molecular weight of 411.24 g/mol. Its IUPAC name is 2-[[(3aS,4R,7aR)-5-iodo-2,2,7a-trimethyl-4,7-dihydro-3aH-1,3-benzodioxol-4-yl]oxy]-N-methoxy-N-methylacetamide.
| Compound Name | 2-[[(3aS,4R,7aR)-5-iodo-2,2,7a-trimethyl-4,7-dihydro-3aH-1,3-benzodioxol-4-yl]oxy]-N-methoxy-N-methylacetamide |
|---|---|
| PubChem CID | 11825762 |
| Molecular Formula | C14H22INO5 |
| Molecular Weight | 411.24 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 2-[[(3aS,4R,7aR)-5-iodo-2,2,7a-trimethyl-4,7-dihydro-3aH-1,3-benzodioxol-4-yl]oxy]-N-methoxy-N-methylacetamide |
| SMILES | CON(C)C(=O)CO[C@H]1C(I)=CC[C@@]2(C)OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H22INO5/c1-13(2)20-12-11(19-8-10(17)16(4)18-5)9(15)6-7-14(12,3)21-13/h6,11-12H,7-8H2,1-5H3/t11-,12-,14+/m0/s1 |
| InChIKey | YPASHPFZLMILLQ-SGMGOOAPSA-N |
| XLogP | 2.02 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.24 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|