C9H16N2O — CID 118258290
(4aR,7aR)-3,3-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[b]pyrazin-2-one (PubChem CID 118258290) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is (4aR,7aR)-3,3-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[b]pyrazin-2-one.
| Compound Name | (4aR,7aR)-3,3-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[b]pyrazin-2-one |
|---|---|
| PubChem CID | 118258290 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | (4aR,7aR)-3,3-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[b]pyrazin-2-one |
| SMILES | CC1(C)N[C@@H]2CCC[C@H]2NC1=O |
| InChI | InChI=1S/C9H16N2O/c1-9(2)8(12)10-6-4-3-5-7(6)11-9/h6-7,11H,3-5H2,1-2H3,(H,10,12)/t6-,7-/m1/s1 |
| InChIKey | SATOKKZSTJTMBB-RNFRBKRXSA-N |
| XLogP | 0.41 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |