C4H3F6N3 — CID 118258796
2-azido-1,1,1,3,3,3-hexafluoro-2-methylpropane (PubChem CID 118258796) has the molecular formula C4H3F6N3 and a molecular weight of 207.08 g/mol. Its IUPAC name is 2-azido-1,1,1,3,3,3-hexafluoro-2-methylpropane.
| Compound Name | 2-azido-1,1,1,3,3,3-hexafluoro-2-methylpropane |
|---|---|
| PubChem CID | 118258796 |
| Molecular Formula | C4H3F6N3 |
| Molecular Weight | 207.08 g/mol |
| Exact Mass | 207.02 |
| IUPAC Name | 2-azido-1,1,1,3,3,3-hexafluoro-2-methylpropane |
| SMILES | CC(N=[N+]=[N-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C4H3F6N3/c1-2(12-13-11,3(5,6)7)4(8,9)10/h1H3 |
| InChIKey | URXMDUILKLVJHA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|