C16H21F3O2 — CID 118258849
1,1,1-trifluoropropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 118258849) has the molecular formula C16H21F3O2 and a molecular weight of 302.34 g/mol. Its IUPAC name is 1,1,1-trifluoropropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 1,1,1-trifluoropropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 118258849 |
| Molecular Formula | C16H21F3O2 |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1,1,1-trifluoropropan-2-yl tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CC(OC(=O)C1CC2CC1C1C3CCC(C3)C21)C(F)(F)F |
| InChI | InChI=1S/C16H21F3O2/c1-7(16(17,18)19)21-15(20)12-6-10-5-11(12)14-9-3-2-8(4-9)13(10)14/h7-14H,2-6H2,1H3 |
| InChIKey | ODHSPESDHAPSTF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|