About 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione
5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione (PubChem CID 118258854) has the molecular formula C14H13NO2
and a molecular weight of 227.26 g/mol. Its IUPAC name is 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione.
Molecular Properties
| Compound Name | 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione |
| PubChem CID | 118258854 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione |
| SMILES | CC(C)(C)C#Cc1ccc2c(c1)C(=O)NC2=O |
| InChI | InChI=1S/C14H13NO2/c1-14(2,3)7-6-9-4-5-10-11(8-9)13(17)15-12(10)16/h4-5,8H,1-3H3,(H,15,16,17) |
| InChIKey | LTUCUSHQKNFJQW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione?
The IUPAC name of 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione (CID 118258854) is 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione.
What is the SMILES notation for 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione?
The canonical SMILES for 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione is CC(C)(C)C#Cc1ccc2c(c1)C(=O)NC2=O.
What is the InChIKey of 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione?
The InChIKey is LTUCUSHQKNFJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO2/c1-14(2,3)7-6-9-4-5-10-11(8-9)13(17)15-12(10)16/h4-5,8H,1-3H3,(H,15,16,17).
What are the key properties of 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione?
5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione has a molecular weight of 227.26 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,3-dimethylbut-1-ynyl)isoindole-1,3-dione is sourced from PubChem (CID 118258854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).