C16H23N — CID 118259231
3-[(Z)-but-1-enyl]-1-[(E)-but-1-enyl]-3a,6,7,7a-tetrahydroindole (PubChem CID 118259231) has the molecular formula C16H23N and a molecular weight of 229.37 g/mol. Its IUPAC name is 3-[(Z)-but-1-enyl]-1-[(E)-but-1-enyl]-3a,6,7,7a-tetrahydroindole.
| Compound Name | 3-[(Z)-but-1-enyl]-1-[(E)-but-1-enyl]-3a,6,7,7a-tetrahydroindole |
|---|---|
| PubChem CID | 118259231 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 3-[(Z)-but-1-enyl]-1-[(E)-but-1-enyl]-3a,6,7,7a-tetrahydroindole |
| SMILES | CC/C=C\C1=CN(/C=C/CC)C2CCC=CC12 |
| InChI | InChI=1S/C16H23N/c1-3-5-9-14-13-17(12-6-4-2)16-11-8-7-10-15(14)16/h5-7,9-10,12-13,15-16H,3-4,8,11H2,1-2H3/b9-5-,12-6+ |
| InChIKey | XZUYMZOHNBJENA-JBSCERNYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|