About trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide
trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide (PubChem CID 11825927) has the molecular formula C26H21N5O
and a molecular weight of 419.49 g/mol. Its IUPAC name is trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide.
Molecular Properties
| Compound Name | trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide |
| PubChem CID | 11825927 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide |
| SMILES | [N-]=[N+]=NC(=O)[C@@H]1C[C@H]1c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1 |
| InChI | InChI=1S/C26H21N5O/c27-30-29-25(32)23-16-22(23)24-17-31(18-28-24)26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17-18,22-23H,16H2/t22-,23-/m1/s1 |
| InChIKey | BOSCWQDHBZDOIM-DHIUTWEWSA-N |
| XLogP | 5.66 |
| TPSA | 83.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide?
The IUPAC name of trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide (CID 11825927) is trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide.
What is the SMILES notation for trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide?
The canonical SMILES for trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide is [N-]=[N+]=NC(=O)[C@@H]1C[C@H]1c1cn(C(c2ccccc2)(c2ccccc2)c2ccccc2)cn1.
What is the InChIKey of trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide?
The InChIKey is BOSCWQDHBZDOIM-DHIUTWEWSA-N. The full InChI is InChI=1S/C26H21N5O/c27-30-29-25(32)23-16-22(23)24-17-31(18-28-24)26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,17-18,22-23H,16H2/t22-,23-/m1/s1.
What are the key properties of trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide?
trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide has a molecular weight of 419.49 g/mol, XLogP of 5.66, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(1-tritylimidazol-4-yl)cyclopropane-1-carbonyl azide is sourced from PubChem (CID 11825927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).