About 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one
5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one (PubChem CID 118259570) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| PubChem CID | 118259570 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one |
| SMILES | CC(C)c1ccc2[nH]c(=O)[nH]c2n1 |
| InChI | InChI=1S/C9H11N3O/c1-5(2)6-3-4-7-8(10-6)12-9(13)11-7/h3-5H,1-2H3,(H2,10,11,12,13) |
| InChIKey | FOAKCAKWSXZYJT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 61.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
The IUPAC name of 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one (CID 118259570) is 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one.
What is the SMILES notation for 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
The canonical SMILES for 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one is CC(C)c1ccc2[nH]c(=O)[nH]c2n1.
What is the InChIKey of 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
The InChIKey is FOAKCAKWSXZYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-5(2)6-3-4-7-8(10-6)12-9(13)11-7/h3-5H,1-2H3,(H2,10,11,12,13).
What are the key properties of 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one?
5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one has a molecular weight of 177.21 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,3-dihydroimidazo[4,5-b]pyridin-2-one is sourced from PubChem (CID 118259570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).