About (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene
(Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene (PubChem CID 118259756) has the molecular formula C12H24S
and a molecular weight of 200.39 g/mol. Its IUPAC name is (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene.
Molecular Properties
| Compound Name | (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene |
| PubChem CID | 118259756 |
| Molecular Formula | C12H24S |
| Molecular Weight | 200.39 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene |
| SMILES | CC(C)(C)C/C=C\CSC(C)(C)C |
| InChI | InChI=1S/C12H24S/c1-11(2,3)9-7-8-10-13-12(4,5)6/h7-8H,9-10H2,1-6H3/b8-7- |
| InChIKey | UQHGFYOXPVFXGG-FPLPWBNLSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.39 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene?
The IUPAC name of (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene (CID 118259756) is (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene.
What is the SMILES notation for (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene?
The canonical SMILES for (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene is CC(C)(C)C/C=C\CSC(C)(C)C.
What is the InChIKey of (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene?
The InChIKey is UQHGFYOXPVFXGG-FPLPWBNLSA-N. The full InChI is InChI=1S/C12H24S/c1-11(2,3)9-7-8-10-13-12(4,5)6/h7-8H,9-10H2,1-6H3/b8-7-.
What are the key properties of (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene?
(Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene has a molecular weight of 200.39 g/mol, XLogP of 4.51, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1-tert-butylsulfanyl-5,5-dimethylhex-2-ene is sourced from PubChem (CID 118259756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).