C28H36N2O2S — CID 118260172
(E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-9-(methylamino)non-3-en-1-one (PubChem CID 118260172) has the molecular formula C28H36N2O2S and a molecular weight of 464.68 g/mol. Its IUPAC name is (E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-9-(methylamino)non-3-en-1-one.
| Compound Name | (E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-9-(methylamino)non-3-en-1-one |
|---|---|
| PubChem CID | 118260172 |
| Molecular Formula | C28H36N2O2S |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.25 |
| IUPAC Name | (E)-1-[(4S)-5,5-diphenyl-4-propan-2-yl-2-sulfanylidene-1,3-oxazolidin-3-yl]-9-(methylamino)non-3-en-1-one |
| SMILES | CNCCCCC/C=C/CC(=O)N1C(=S)OC(c2ccccc2)(c2ccccc2)[C@@H]1C(C)C |
| InChI | InChI=1S/C28H36N2O2S/c1-22(2)26-28(23-16-10-8-11-17-23,24-18-12-9-13-19-24)32-27(33)30(26)25(31)20-14-6-4-5-7-15-21-29-3/h6,8-14,16-19,22,26,29H,4-5,7,15,20-21H2,1-3H3/b14-6+/t26-/m0/s1 |
| InChIKey | GMZSFFKPCQVRKB-CUHAHGGPSA-N |
| XLogP | 5.82 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|