C29H32N2O — CID 11826034
3-[2-[(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl]-1-benzyl-3-[(1E,3E)-hexa-1,3-dienyl]indol-2-one (PubChem CID 11826034) has the molecular formula C29H32N2O and a molecular weight of 424.59 g/mol. Its IUPAC name is 3-[2-[(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl]-1-benzyl-3-[(1E,3E)-hexa-1,3-dienyl]indol-2-one.
| Compound Name | 3-[2-[(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl]-1-benzyl-3-[(1E,3E)-hexa-1,3-dienyl]indol-2-one |
|---|---|
| PubChem CID | 11826034 |
| Molecular Formula | C29H32N2O |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | 3-[2-[(1R,4S)-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl]-1-benzyl-3-[(1E,3E)-hexa-1,3-dienyl]indol-2-one |
| SMILES | CC/C=C/C=C/C1(CCN2C[C@@H]3C=C[C@H]2C3)C(=O)N(Cc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H32N2O/c1-2-3-4-10-17-29(18-19-30-21-24-15-16-25(30)20-24)26-13-8-9-14-27(26)31(28(29)32)22-23-11-6-5-7-12-23/h3-17,24-25H,2,18-22H2,1H3/b4-3+,17-10+/t24-,25+,29?/m1/s1 |
| InChIKey | BVIGAMDYOUTKKS-KPVXFSQASA-N |
| XLogP | 5.64 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|