C16H20N2O4 — CID 118260403
[2,5-bis(aziridin-1-yl)-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl 2-methylpropanoate (PubChem CID 118260403) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is [2,5-bis(aziridin-1-yl)-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl 2-methylpropanoate.
| Compound Name | [2,5-bis(aziridin-1-yl)-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl 2-methylpropanoate |
|---|---|
| PubChem CID | 118260403 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | [2,5-bis(aziridin-1-yl)-4-methyl-3,6-dioxocyclohexa-1,4-dien-1-yl]methyl 2-methylpropanoate |
| SMILES | CC1=C(N2CC2)C(=O)C(COC(=O)C(C)C)=C(N2CC2)C1=O |
| InChI | InChI=1S/C16H20N2O4/c1-9(2)16(21)22-8-11-13(18-6-7-18)14(19)10(3)12(15(11)20)17-4-5-17/h9H,4-8H2,1-3H3 |
| InChIKey | DGOKJQQHPFEUKI-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|