C16H24O2 — CID 118260722
2-(2,4-dimethylpentan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione (PubChem CID 118260722) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-(2,4-dimethylpentan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-(2,4-dimethylpentan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 118260722 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 2-(2,4-dimethylpentan-2-yl)-3,5,6-trimethylcyclohexa-2,5-diene-1,4-dione |
| SMILES | CC1=C(C)C(=O)C(C(C)(C)CC(C)C)=C(C)C1=O |
| InChI | InChI=1S/C16H24O2/c1-9(2)8-16(6,7)13-12(5)14(17)10(3)11(4)15(13)18/h9H,8H2,1-7H3 |
| InChIKey | JPOSOZSVFMQNGU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|