C32H20F5N3O3 — CID 118260741
[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] 2-(2,3,4,5,6-pentafluorophenyl)acetate (PubChem CID 118260741) has the molecular formula C32H20F5N3O3 and a molecular weight of 589.52 g/mol. Its IUPAC name is [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] 2-(2,3,4,5,6-pentafluorophenyl)acetate.
| Compound Name | [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] 2-(2,3,4,5,6-pentafluorophenyl)acetate |
|---|---|
| PubChem CID | 118260741 |
| Molecular Formula | C32H20F5N3O3 |
| Molecular Weight | 589.52 g/mol |
| Exact Mass | 589.14 |
| IUPAC Name | [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] 2-(2,3,4,5,6-pentafluorophenyl)acetate |
| SMILES | O=C(Cc1c(F)c(F)c(F)c(F)c1F)Oc1c(Cc2ccco2)nc2c(Cc3ccccc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C32H20F5N3O3/c33-26-21(27(34)29(36)30(37)28(26)35)16-25(41)43-32-23(15-20-12-7-13-42-20)39-31-22(14-18-8-3-1-4-9-18)38-24(17-40(31)32)19-10-5-2-6-11-19/h1-13,17H,14-16H2 |
| InChIKey | ZBGGIZWJQKXAAZ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.52 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|