C19H17F3N4O — CID 118261126
11-(3,4-difluoroanilino)-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118261126) has the molecular formula C19H17F3N4O and a molecular weight of 374.37 g/mol. Its IUPAC name is 11-(3,4-difluoroanilino)-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-(3,4-difluoroanilino)-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118261126 |
| Molecular Formula | C19H17F3N4O |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 11-(3,4-difluoroanilino)-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | Cn1c2c(c3ccc(Nc4ccc(F)c(F)c4)nc31)C(=O)N(CCF)CC2 |
| InChI | InChI=1S/C19H17F3N4O/c1-25-15-6-8-26(9-7-20)19(27)17(15)12-3-5-16(24-18(12)25)23-11-2-4-13(21)14(22)10-11/h2-5,10H,6-9H2,1H3,(H,23,24) |
| InChIKey | NJOQAUCHQWCONM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |