C13H13BrFN3O — CID 118261130
11-bromo-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118261130) has the molecular formula C13H13BrFN3O and a molecular weight of 326.17 g/mol. Its IUPAC name is 11-bromo-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-bromo-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118261130 |
| Molecular Formula | C13H13BrFN3O |
| Molecular Weight | 326.17 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 11-bromo-4-(2-fluoroethyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | Cn1c2c(c3ccc(Br)nc31)C(=O)N(CCF)CC2 |
| InChI | InChI=1S/C13H13BrFN3O/c1-17-9-4-6-18(7-5-15)13(19)11(9)8-2-3-10(14)16-12(8)17/h2-3H,4-7H2,1H3 |
| InChIKey | NATGSPYLMHSRGC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.17 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|