C17H16FN5O — CID 118261131
11-[(6-fluoro-2-pyridinyl)amino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118261131) has the molecular formula C17H16FN5O and a molecular weight of 325.35 g/mol. Its IUPAC name is 11-[(6-fluoro-2-pyridinyl)amino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[(6-fluoro-2-pyridinyl)amino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118261131 |
| Molecular Formula | C17H16FN5O |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 11-[(6-fluoro-2-pyridinyl)amino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | CN1CCc2c(c3ccc(Nc4cccc(F)n4)nc3n2C)C1=O |
| InChI | InChI=1S/C17H16FN5O/c1-22-9-8-11-15(17(22)24)10-6-7-14(21-16(10)23(11)2)20-13-5-3-4-12(18)19-13/h3-7H,8-9H2,1-2H3,(H,19,20,21) |
| InChIKey | NFEGDQCGLOMXKA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|