C16H14FN5O — CID 118261133
11-[(6-fluoro-2-pyridinyl)amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118261133) has the molecular formula C16H14FN5O and a molecular weight of 311.32 g/mol. Its IUPAC name is 11-[(6-fluoro-2-pyridinyl)amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[(6-fluoro-2-pyridinyl)amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118261133 |
| Molecular Formula | C16H14FN5O |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 11-[(6-fluoro-2-pyridinyl)amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | Cn1c2c(c3ccc(Nc4cccc(F)n4)nc31)C(=O)NCC2 |
| InChI | InChI=1S/C16H14FN5O/c1-22-10-7-8-18-16(23)14(10)9-5-6-13(21-15(9)22)20-12-4-2-3-11(17)19-12/h2-6H,7-8H2,1H3,(H,18,23)(H,19,20,21) |
| InChIKey | XQAIKGFZCGBECW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|