About [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate
[1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate (PubChem CID 118261283) has the molecular formula C14H22F2O5
and a molecular weight of 308.32 g/mol. Its IUPAC name is [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate |
| PubChem CID | 118261283 |
| Molecular Formula | C14H22F2O5 |
| Molecular Weight | 308.32 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate |
| SMILES | CC(=O)OCC(COC(C)(F)F)OC(=O)C1CCCCC1 |
| InChI | InChI=1S/C14H22F2O5/c1-10(17)19-8-12(9-20-14(2,15)16)21-13(18)11-6-4-3-5-7-11/h11-12H,3-9H2,1-2H3 |
| InChIKey | GVUJUADGPBFRMZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.32 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate?
The IUPAC name of [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate (CID 118261283) is [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate.
What is the SMILES notation for [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate?
The canonical SMILES for [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate is CC(=O)OCC(COC(C)(F)F)OC(=O)C1CCCCC1.
What is the InChIKey of [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate?
The InChIKey is GVUJUADGPBFRMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22F2O5/c1-10(17)19-8-12(9-20-14(2,15)16)21-13(18)11-6-4-3-5-7-11/h11-12H,3-9H2,1-2H3.
What are the key properties of [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate?
[1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate has a molecular weight of 308.32 g/mol, XLogP of 2.67, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-acetyloxy-3-(1,1-difluoroethoxy)propan-2-yl] cyclohexanecarboxylate is sourced from PubChem (CID 118261283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).