C37H32Cl2N4O5 — CID 118261664
[1-(chloromethyl)-3-[5-[1-(chloromethyl)-5-prop-1-en-2-yloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1-methylpyrazole-3-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate (PubChem CID 118261664) has the molecular formula C37H32Cl2N4O5 and a molecular weight of 683.59 g/mol. Its IUPAC name is [1-(chloromethyl)-3-[5-[1-(chloromethyl)-5-prop-1-en-2-yloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1-methylpyrazole-3-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate.
| Compound Name | [1-(chloromethyl)-3-[5-[1-(chloromethyl)-5-prop-1-en-2-yloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1-methylpyrazole-3-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate |
|---|---|
| PubChem CID | 118261664 |
| Molecular Formula | C37H32Cl2N4O5 |
| Molecular Weight | 683.59 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | [1-(chloromethyl)-3-[5-[1-(chloromethyl)-5-prop-1-en-2-yloxy-1,2-dihydrobenzo[e]indole-3-carbonyl]-1-methylpyrazole-3-carbonyl]-1,2-dihydrobenzo[e]indol-5-yl] acetate |
| SMILES | C=C(C)Oc1cc2c(c3ccccc13)C(CCl)CN2C(=O)c1cc(C(=O)N2CC(CCl)c3c2cc(OC(C)=O)c2ccccc32)nn1C |
| InChI | InChI=1S/C37H32Cl2N4O5/c1-20(2)47-32-14-30-35(26-11-7-5-9-24(26)32)23(17-39)19-43(30)37(46)31-13-28(40-41(31)4)36(45)42-18-22(16-38)34-27-12-8-6-10-25(27)33(15-29(34)42)48-21(3)44/h5-15,22-23H,1,16-19H2,2-4H3 |
| InChIKey | GQQHJBFWBLKXBW-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 93.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.59 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|