About [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate
[3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate (PubChem CID 118262043) has the molecular formula C13H21FO3S2
and a molecular weight of 308.44 g/mol. Its IUPAC name is [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate |
| PubChem CID | 118262043 |
| Molecular Formula | C13H21FO3S2 |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate |
| SMILES | CC(C)(F)C(=O)OC1CCCCC12SCC(CO)S2 |
| InChI | InChI=1S/C13H21FO3S2/c1-12(2,14)11(16)17-10-5-3-4-6-13(10)18-8-9(7-15)19-13/h9-10,15H,3-8H2,1-2H3 |
| InChIKey | NPFSVEXYRORNQG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate?
The IUPAC name of [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate (CID 118262043) is [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate.
What is the SMILES notation for [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate?
The canonical SMILES for [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate is CC(C)(F)C(=O)OC1CCCCC12SCC(CO)S2.
What is the InChIKey of [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate?
The InChIKey is NPFSVEXYRORNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21FO3S2/c1-12(2,14)11(16)17-10-5-3-4-6-13(10)18-8-9(7-15)19-13/h9-10,15H,3-8H2,1-2H3.
What are the key properties of [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate?
[3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate has a molecular weight of 308.44 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-1,4-dithiaspiro[4.5]decan-6-yl] 2-fluoro-2-methylpropanoate is sourced from PubChem (CID 118262043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).