About (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole
(2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole (PubChem CID 118262158) has the molecular formula C28H27N3
and a molecular weight of 405.55 g/mol. Its IUPAC name is (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole |
| PubChem CID | 118262158 |
| Molecular Formula | C28H27N3 |
| Molecular Weight | 405.55 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole |
| SMILES | Cc1ccn(-c2c(-c3ccccc3)cccc2-c2ccccc2)c1N1C=CN(C)[C@@H]1C |
| InChI | InChI=1S/C28H27N3/c1-21-17-18-31(28(21)30-20-19-29(3)22(30)2)27-25(23-11-6-4-7-12-23)15-10-16-26(27)24-13-8-5-9-14-24/h4-20,22H,1-3H3/t22-/m0/s1 |
| InChIKey | ZAWIFIDITMZYLK-QFIPXVFZSA-N |
| XLogP | 6.69 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole?
The IUPAC name of (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole (CID 118262158) is (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole.
What is the SMILES notation for (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole?
The canonical SMILES for (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole is Cc1ccn(-c2c(-c3ccccc3)cccc2-c2ccccc2)c1N1C=CN(C)[C@@H]1C.
What is the InChIKey of (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole?
The InChIKey is ZAWIFIDITMZYLK-QFIPXVFZSA-N. The full InChI is InChI=1S/C28H27N3/c1-21-17-18-31(28(21)30-20-19-29(3)22(30)2)27-25(23-11-6-4-7-12-23)15-10-16-26(27)24-13-8-5-9-14-24/h4-20,22H,1-3H3/t22-/m0/s1.
What are the key properties of (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole?
(2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole has a molecular weight of 405.55 g/mol, XLogP of 6.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-[1-(2,6-diphenylphenyl)-3-methylpyrrol-2-yl]-2,3-dimethyl-2H-imidazole is sourced from PubChem (CID 118262158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).