C19H19FN4O — CID 118262182
11-(4-fluoro-3-methylanilino)-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118262182) has the molecular formula C19H19FN4O and a molecular weight of 338.39 g/mol. Its IUPAC name is 11-(4-fluoro-3-methylanilino)-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-(4-fluoro-3-methylanilino)-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118262182 |
| Molecular Formula | C19H19FN4O |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 11-(4-fluoro-3-methylanilino)-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | Cc1cc(Nc2ccc3c4c(n(C)c3n2)CCN(C)C4=O)ccc1F |
| InChI | InChI=1S/C19H19FN4O/c1-11-10-12(4-6-14(11)20)21-16-7-5-13-17-15(24(3)18(13)22-16)8-9-23(2)19(17)25/h4-7,10H,8-9H2,1-3H3,(H,21,22) |
| InChIKey | SJIVLXWKBJBZFA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |