C22H23N3 — CID 118262199
8-(2-propan-2-ylphenyl)-13-(trideuteriomethyl)-8,10,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene (PubChem CID 118262199) has the molecular formula C22H23N3 and a molecular weight of 332.47 g/mol. Its IUPAC name is 8-(2-propan-2-ylphenyl)-13-(trideuteriomethyl)-8,10,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene.
| Compound Name | 8-(2-propan-2-ylphenyl)-13-(trideuteriomethyl)-8,10,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene |
|---|---|
| PubChem CID | 118262199 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 8-(2-propan-2-ylphenyl)-13-(trideuteriomethyl)-8,10,13-triazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene |
| SMILES | [2H]C([2H])([2H])N1C=CN2c3c(c4ccccc4n3-c3ccccc3C(C)C)CC21 |
| InChI | InChI=1S/C22H23N3/c1-15(2)16-8-4-6-10-19(16)25-20-11-7-5-9-17(20)18-14-21-23(3)12-13-24(21)22(18)25/h4-13,15,21H,14H2,1-3H3/i3D3 |
| InChIKey | PKPAUTITULCSGQ-HPRDVNIFSA-N |
| XLogP | 4.86 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |