C21H20N6O4 — CID 118262250
tert-butyl N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-N-(2-nitro-4-pyridinyl)carbamate (PubChem CID 118262250) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is tert-butyl N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-N-(2-nitro-4-pyridinyl)carbamate.
| Compound Name | tert-butyl N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-N-(2-nitro-4-pyridinyl)carbamate |
|---|---|
| PubChem CID | 118262250 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | tert-butyl N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-N-(2-nitro-4-pyridinyl)carbamate |
| SMILES | Cn1c2ccncc2c2ccc(N(C(=O)OC(C)(C)C)c3ccnc([N+](=O)[O-])c3)nc21 |
| InChI | InChI=1S/C21H20N6O4/c1-21(2,3)31-20(28)26(13-7-10-23-18(11-13)27(29)30)17-6-5-14-15-12-22-9-8-16(15)25(4)19(14)24-17/h5-12H,1-4H3 |
| InChIKey | PLOHQYZVQQEHGH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|