C17H15N5O — CID 118262281
N-(2-methoxy-4-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262281) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is N-(2-methoxy-4-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-(2-methoxy-4-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262281 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | N-(2-methoxy-4-pyridinyl)-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | COc1cc(Nc2ccc3c4cnccc4n(C)c3n2)ccn1 |
| InChI | InChI=1S/C17H15N5O/c1-22-14-6-7-18-10-13(14)12-3-4-15(21-17(12)22)20-11-5-8-19-16(9-11)23-2/h3-10H,1-2H3,(H,19,20,21) |
| InChIKey | BVDUMBZZCXDFDU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |