C20H18N6O4 — CID 118262304
tert-butyl N-(4-nitro-2-pyridinyl)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)carbamate (PubChem CID 118262304) has the molecular formula C20H18N6O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is tert-butyl N-(4-nitro-2-pyridinyl)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)carbamate.
| Compound Name | tert-butyl N-(4-nitro-2-pyridinyl)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)carbamate |
|---|---|
| PubChem CID | 118262304 |
| Molecular Formula | C20H18N6O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | tert-butyl N-(4-nitro-2-pyridinyl)-N-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1cc([N+](=O)[O-])ccn1)c1ccc2c(n1)[nH]c1ccncc12 |
| InChI | InChI=1S/C20H18N6O4/c1-20(2,3)30-19(27)25(17-10-12(26(28)29)6-9-22-17)16-5-4-13-14-11-21-8-7-15(14)23-18(13)24-16/h4-11H,1-3H3,(H,23,24) |
| InChIKey | VEZOYXGJEFOMGG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 127.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|