C20H22FN5O — CID 118262307
11-[3-(2-fluoroethylamino)anilino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118262307) has the molecular formula C20H22FN5O and a molecular weight of 367.43 g/mol. Its IUPAC name is 11-[3-(2-fluoroethylamino)anilino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[3-(2-fluoroethylamino)anilino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118262307 |
| Molecular Formula | C20H22FN5O |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 11-[3-(2-fluoroethylamino)anilino]-4,8-dimethyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | CN1CCc2c(c3ccc(Nc4cccc(NCCF)c4)nc3n2C)C1=O |
| InChI | InChI=1S/C20H22FN5O/c1-25-11-8-16-18(20(25)27)15-6-7-17(24-19(15)26(16)2)23-14-5-3-4-13(12-14)22-10-9-21/h3-7,12,22H,8-11H2,1-2H3,(H,23,24) |
| InChIKey | UVIQVEROLMECNC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |