C18H17N5O2 — CID 118262436
2-[[6-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-2-pyridinyl]oxy]ethanol (PubChem CID 118262436) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 2-[[6-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-2-pyridinyl]oxy]ethanol.
| Compound Name | 2-[[6-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-2-pyridinyl]oxy]ethanol |
|---|---|
| PubChem CID | 118262436 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[[6-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-2-pyridinyl]oxy]ethanol |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cccc(OCCO)n3)nc21 |
| InChI | InChI=1S/C18H17N5O2/c1-23-14-7-8-19-11-13(14)12-5-6-16(22-18(12)23)20-15-3-2-4-17(21-15)25-10-9-24/h2-8,11,24H,9-10H2,1H3,(H,20,21,22) |
| InChIKey | XCLBVSHATJSYDD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |