C18H21FN4O — CID 118262461
11-[4-(2-fluoroethoxy)piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 118262461) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is 11-[4-(2-fluoroethoxy)piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-[4-(2-fluoroethoxy)piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 118262461 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 11-[4-(2-fluoroethoxy)piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cn1c2ccncc2c2ccc(N3CCC(OCCF)CC3)nc21 |
| InChI | InChI=1S/C18H21FN4O/c1-22-16-4-8-20-12-15(16)14-2-3-17(21-18(14)22)23-9-5-13(6-10-23)24-11-7-19/h2-4,8,12-13H,5-7,9-11H2,1H3 |
| InChIKey | MRJJKZXWIOFHME-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |