C16H14FN5OS — CID 118262481
2-(2-fluoroethoxy)-N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-1,3-thiazol-4-amine (PubChem CID 118262481) has the molecular formula C16H14FN5OS and a molecular weight of 343.39 g/mol. Its IUPAC name is 2-(2-fluoroethoxy)-N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-1,3-thiazol-4-amine.
| Compound Name | 2-(2-fluoroethoxy)-N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 118262481 |
| Molecular Formula | C16H14FN5OS |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 2-(2-fluoroethoxy)-N-(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)-1,3-thiazol-4-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3csc(OCCF)n3)nc21 |
| InChI | InChI=1S/C16H14FN5OS/c1-22-12-4-6-18-8-11(12)10-2-3-13(20-15(10)22)19-14-9-24-16(21-14)23-7-5-17/h2-4,6,8-9H,5,7H2,1H3,(H,19,20) |
| InChIKey | LNKIYXYYNOUWGI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |