C22H23FN6O2 — CID 118262483
tert-butyl N-(2-fluoroethyl)-N-[6-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)-2-pyridinyl]carbamate (PubChem CID 118262483) has the molecular formula C22H23FN6O2 and a molecular weight of 422.46 g/mol. Its IUPAC name is tert-butyl N-(2-fluoroethyl)-N-[6-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-(2-fluoroethyl)-N-[6-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 118262483 |
| Molecular Formula | C22H23FN6O2 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | tert-butyl N-(2-fluoroethyl)-N-[6-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)-2-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCF)c1cccc(Nc2ccc3c(n2)[nH]c2ccncc23)n1 |
| InChI | InChI=1S/C22H23FN6O2/c1-22(2,3)31-21(30)29(12-10-23)19-6-4-5-17(27-19)26-18-8-7-14-15-13-24-11-9-16(15)25-20(14)28-18/h4-9,11,13H,10,12H2,1-3H3,(H2,25,26,27,28) |
| InChIKey | SDGQGBXROBIKPK-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |