C19H17FN4O2 — CID 118262505
11-[3-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one (PubChem CID 118262505) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is 11-[3-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one.
| Compound Name | 11-[3-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one |
|---|---|
| PubChem CID | 118262505 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 11-[3-(2-fluoroethoxy)anilino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5,10,12-pentaen-3-one |
| SMILES | Cn1c2cc[nH]c(=O)c2c2ccc(Nc3cccc(OCCF)c3)nc21 |
| InChI | InChI=1S/C19H17FN4O2/c1-24-15-7-9-21-19(25)17(15)14-5-6-16(23-18(14)24)22-12-3-2-4-13(11-12)26-10-8-20/h2-7,9,11H,8,10H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | ZZENOFVCUBSEJI-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |