C16H13N5O — CID 118262515
2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-1H-pyridin-4-one (PubChem CID 118262515) has the molecular formula C16H13N5O and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-1H-pyridin-4-one.
| Compound Name | 2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-1H-pyridin-4-one |
|---|---|
| PubChem CID | 118262515 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 2-[(8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-yl)amino]-1H-pyridin-4-one |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cc(=O)cc[nH]3)nc21 |
| InChI | InChI=1S/C16H13N5O/c1-21-13-5-6-17-9-12(13)11-2-3-14(20-16(11)21)19-15-8-10(22)4-7-18-15/h2-9H,1H3,(H2,18,19,20,22) |
| InChIKey | ZBXUESSZBOCPKD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |