C23H25FN4O3 — CID 118262543
N-[3-(2-fluoroethoxy)phenyl]-8-[2-(2-methoxyethoxy)ethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262543) has the molecular formula C23H25FN4O3 and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[3-(2-fluoroethoxy)phenyl]-8-[2-(2-methoxyethoxy)ethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[3-(2-fluoroethoxy)phenyl]-8-[2-(2-methoxyethoxy)ethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262543 |
| Molecular Formula | C23H25FN4O3 |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-[3-(2-fluoroethoxy)phenyl]-8-[2-(2-methoxyethoxy)ethyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | COCCOCCn1c2ccncc2c2ccc(Nc3cccc(OCCF)c3)nc21 |
| InChI | InChI=1S/C23H25FN4O3/c1-29-13-14-30-12-10-28-21-7-9-25-16-20(21)19-5-6-22(27-23(19)28)26-17-3-2-4-18(15-17)31-11-8-24/h2-7,9,15-16H,8,10-14H2,1H3,(H,26,27) |
| InChIKey | WDMAYFBZOQESHY-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|