C21H21FN4O2 — CID 118262609
N-[3-[2-(2-fluoroethoxy)ethoxy]phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262609) has the molecular formula C21H21FN4O2 and a molecular weight of 380.42 g/mol. Its IUPAC name is N-[3-[2-(2-fluoroethoxy)ethoxy]phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[3-[2-(2-fluoroethoxy)ethoxy]phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262609 |
| Molecular Formula | C21H21FN4O2 |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | N-[3-[2-(2-fluoroethoxy)ethoxy]phenyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cccc(OCCOCCF)c3)nc21 |
| InChI | InChI=1S/C21H21FN4O2/c1-26-19-7-9-23-14-18(19)17-5-6-20(25-21(17)26)24-15-3-2-4-16(13-15)28-12-11-27-10-8-22/h2-7,9,13-14H,8,10-12H2,1H3,(H,24,25) |
| InChIKey | LKPXCDBDXXAWBS-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 61.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|