C22H23FN4O3 — CID 118262625
N-[3-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262625) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is N-[3-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[3-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262625 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | N-[3-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]phenyl]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | FCCOCCOCCOc1cccc(Nc2ccc3c(n2)[nH]c2ccncc23)c1 |
| InChI | InChI=1S/C22H23FN4O3/c23-7-9-28-10-11-29-12-13-30-17-3-1-2-16(14-17)25-21-5-4-18-19-15-24-8-6-20(19)26-22(18)27-21/h1-6,8,14-15H,7,9-13H2,(H2,25,26,27) |
| InChIKey | LEAJGSUBJSNLGR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|