C15H11N5O — CID 118262749
5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)pyridin-3-ol (PubChem CID 118262749) has the molecular formula C15H11N5O and a molecular weight of 277.29 g/mol. Its IUPAC name is 5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)pyridin-3-ol.
| Compound Name | 5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)pyridin-3-ol |
|---|---|
| PubChem CID | 118262749 |
| Molecular Formula | C15H11N5O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-(4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-ylamino)pyridin-3-ol |
| SMILES | Oc1cncc(Nc2ccc3c(n2)[nH]c2ccncc23)c1 |
| InChI | InChI=1S/C15H11N5O/c21-10-5-9(6-17-7-10)18-14-2-1-11-12-8-16-4-3-13(12)19-15(11)20-14/h1-8,21H,(H2,18,19,20) |
| InChIKey | BKTHKWCRMHMDTB-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |