C20H25FN4O2 — CID 118262766
11-[4-[2-(2-fluoroethoxy)ethoxy]piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene (PubChem CID 118262766) has the molecular formula C20H25FN4O2 and a molecular weight of 372.44 g/mol. Its IUPAC name is 11-[4-[2-(2-fluoroethoxy)ethoxy]piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene.
| Compound Name | 11-[4-[2-(2-fluoroethoxy)ethoxy]piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
|---|---|
| PubChem CID | 118262766 |
| Molecular Formula | C20H25FN4O2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 11-[4-[2-(2-fluoroethoxy)ethoxy]piperidin-1-yl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene |
| SMILES | Cn1c2ccncc2c2ccc(N3CCC(OCCOCCF)CC3)nc21 |
| InChI | InChI=1S/C20H25FN4O2/c1-24-18-4-8-22-14-17(18)16-2-3-19(23-20(16)24)25-9-5-15(6-10-25)27-13-12-26-11-7-21/h2-4,8,14-15H,5-7,9-13H2,1H3 |
| InChIKey | JUGOQEPWZPIPNI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 52.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|