C20H20FN5O2 — CID 118262774
N-[6-[2-(2-fluoroethoxy)ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262774) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[6-[2-(2-fluoroethoxy)ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[6-[2-(2-fluoroethoxy)ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262774 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | N-[6-[2-(2-fluoroethoxy)ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cccc(OCCOCCF)n3)nc21 |
| InChI | InChI=1S/C20H20FN5O2/c1-26-16-7-9-22-13-15(16)14-5-6-18(25-20(14)26)23-17-3-2-4-19(24-17)28-12-11-27-10-8-21/h2-7,9,13H,8,10-12H2,1H3,(H,23,24,25) |
| InChIKey | CKSRVDWZNKFMQC-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|