C22H24FN5O3 — CID 118262810
N-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine (PubChem CID 118262810) has the molecular formula C22H24FN5O3 and a molecular weight of 425.46 g/mol. Its IUPAC name is N-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine.
| Compound Name | N-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
|---|---|
| PubChem CID | 118262810 |
| Molecular Formula | C22H24FN5O3 |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.19 |
| IUPAC Name | N-[6-[2-[2-(2-fluoroethoxy)ethoxy]ethoxy]-2-pyridinyl]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-11-amine |
| SMILES | Cn1c2ccncc2c2ccc(Nc3cccc(OCCOCCOCCF)n3)nc21 |
| InChI | InChI=1S/C22H24FN5O3/c1-28-18-7-9-24-15-17(18)16-5-6-20(27-22(16)28)25-19-3-2-4-21(26-19)31-14-13-30-12-11-29-10-8-23/h2-7,9,15H,8,10-14H2,1H3,(H,25,26,27) |
| InChIKey | GAJYPPVAEAFWOH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|