C18H16F2N4O2 — CID 118262811
11-[3-fluoro-4-(2-fluoroethoxy)anilino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118262811) has the molecular formula C18H16F2N4O2 and a molecular weight of 358.35 g/mol. Its IUPAC name is 11-[3-fluoro-4-(2-fluoroethoxy)anilino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[3-fluoro-4-(2-fluoroethoxy)anilino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118262811 |
| Molecular Formula | C18H16F2N4O2 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 11-[3-fluoro-4-(2-fluoroethoxy)anilino]-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | O=C1NCCc2[nH]c3nc(Nc4ccc(OCCF)c(F)c4)ccc3c21 |
| InChI | InChI=1S/C18H16F2N4O2/c19-6-8-26-14-3-1-10(9-12(14)20)22-15-4-2-11-16-13(23-17(11)24-15)5-7-21-18(16)25/h1-4,9H,5-8H2,(H,21,25)(H2,22,23,24) |
| InChIKey | OOCUCFHWLNXONW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |