C18H18FN5O2 — CID 118262827
11-[[5-(2-fluoroethoxy)-2-pyridinyl]amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one (PubChem CID 118262827) has the molecular formula C18H18FN5O2 and a molecular weight of 355.37 g/mol. Its IUPAC name is 11-[[5-(2-fluoroethoxy)-2-pyridinyl]amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one.
| Compound Name | 11-[[5-(2-fluoroethoxy)-2-pyridinyl]amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
|---|---|
| PubChem CID | 118262827 |
| Molecular Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | 11-[[5-(2-fluoroethoxy)-2-pyridinyl]amino]-8-methyl-4,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),10,12-tetraen-3-one |
| SMILES | Cn1c2c(c3ccc(Nc4ccc(OCCF)cn4)nc31)C(=O)NCC2 |
| InChI | InChI=1S/C18H18FN5O2/c1-24-13-6-8-20-18(25)16(13)12-3-5-15(23-17(12)24)22-14-4-2-11(10-21-14)26-9-7-19/h2-5,10H,6-9H2,1H3,(H,20,25)(H,21,22,23) |
| InChIKey | OMOVGEQQWJUKQV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |