C20H21N5O4S — CID 118262848
[(1S,2S,4R)-2-hydroxy-4-[4-(1H-indol-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methylsulfamic acid (PubChem CID 118262848) has the molecular formula C20H21N5O4S and a molecular weight of 427.49 g/mol. Its IUPAC name is [(1S,2S,4R)-2-hydroxy-4-[4-(1H-indol-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methylsulfamic acid.
| Compound Name | [(1S,2S,4R)-2-hydroxy-4-[4-(1H-indol-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methylsulfamic acid |
|---|---|
| PubChem CID | 118262848 |
| Molecular Formula | C20H21N5O4S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.13 |
| IUPAC Name | [(1S,2S,4R)-2-hydroxy-4-[4-(1H-indol-2-yl)pyrrolo[2,3-d]pyrimidin-7-yl]cyclopentyl]methylsulfamic acid |
| SMILES | O=S(=O)(O)NC[C@@H]1C[C@@H](n2ccc3c(-c4cc5ccccc5[nH]4)ncnc32)C[C@@H]1O |
| InChI | InChI=1S/C20H21N5O4S/c26-18-9-14(7-13(18)10-23-30(27,28)29)25-6-5-15-19(21-11-22-20(15)25)17-8-12-3-1-2-4-16(12)24-17/h1-6,8,11,13-14,18,23-24,26H,7,9-10H2,(H,27,28,29)/t13-,14+,18-/m0/s1 |
| InChIKey | YSOPGRBGTIUPSN-IYOUNJFTSA-N |
| XLogP | 2.28 |
| TPSA | 133.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|