C24H40O7 — CID 11826320
methyl (Z)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate (PubChem CID 11826320) has the molecular formula C24H40O7 and a molecular weight of 440.58 g/mol. Its IUPAC name is methyl (Z)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate.
| Compound Name | methyl (Z)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 11826320 |
| Molecular Formula | C24H40O7 |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | methyl (Z)-7-[(1R,2S,3R,5S)-2-(hydroxymethyl)-3,5-bis(oxan-2-yloxy)cyclopentyl]hept-5-enoate |
| SMILES | COC(=O)CCC/C=C\C[C@@H]1[C@@H](CO)[C@H](OC2CCCCO2)C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C24H40O7/c1-27-22(26)11-5-3-2-4-10-18-19(17-25)21(31-24-13-7-9-15-29-24)16-20(18)30-23-12-6-8-14-28-23/h2,4,18-21,23-25H,3,5-17H2,1H3/b4-2-/t18-,19-,20+,21-,23?,24?/m1/s1 |
| InChIKey | LORMGASDLJAABL-NKTLOOFPSA-N |
| XLogP | 3.73 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|