C24H44O5Si — CID 11826328
(2S,3R,3aR,6S,7S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)-6-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one (PubChem CID 11826328) has the molecular formula C24H44O5Si and a molecular weight of 440.70 g/mol. Its IUPAC name is (2S,3R,3aR,6S,7S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)-6-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one.
| Compound Name | (2S,3R,3aR,6S,7S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)-6-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one |
|---|---|
| PubChem CID | 11826328 |
| Molecular Formula | C24H44O5Si |
| Molecular Weight | 440.70 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (2S,3R,3aR,6S,7S,8aS)-7-[tert-butyl(dimethyl)silyl]oxy-2-(1,3-dioxolan-2-yl)-6-methyl-3-[(2-methylpropan-2-yl)oxy]-2,3,3a,5,6,7,8,8a-octahydro-1H-azulen-4-one |
| SMILES | C[C@H]1CC(=O)[C@@H]2[C@H](C[C@@H]1O[Si](C)(C)C(C)(C)C)C[C@H](C1OCCO1)[C@H]2OC(C)(C)C |
| InChI | InChI=1S/C24H44O5Si/c1-15-12-18(25)20-16(14-19(15)29-30(8,9)24(5,6)7)13-17(22-26-10-11-27-22)21(20)28-23(2,3)4/h15-17,19-22H,10-14H2,1-9H3/t15-,16-,17-,19-,20-,21+/m0/s1 |
| InChIKey | PFWXBCDNBFRHFY-RZCQQDKOSA-N |
| XLogP | 5.18 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.70 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|