About 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one
3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one (PubChem CID 118263591) has the molecular formula C16H11ClN2O2
and a molecular weight of 298.73 g/mol. Its IUPAC name is 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one.
Molecular Properties
| Compound Name | 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one |
| PubChem CID | 118263591 |
| Molecular Formula | C16H11ClN2O2 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one |
| SMILES | O=c1c(C2=NC3C=CC=CC3N2)coc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H11ClN2O2/c17-9-5-6-14-10(7-9)15(20)11(8-21-14)16-18-12-3-1-2-4-13(12)19-16/h1-8,12-13H,(H,18,19) |
| InChIKey | AQTGMSGOKBNVRD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one?
The IUPAC name of 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one (CID 118263591) is 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one.
What is the SMILES notation for 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one?
The canonical SMILES for 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one is O=c1c(C2=NC3C=CC=CC3N2)coc2ccc(Cl)cc12.
What is the InChIKey of 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one?
The InChIKey is AQTGMSGOKBNVRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O2/c17-9-5-6-14-10(7-9)15(20)11(8-21-14)16-18-12-3-1-2-4-13(12)19-16/h1-8,12-13H,(H,18,19).
What are the key properties of 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one?
3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one has a molecular weight of 298.73 g/mol, XLogP of 2.66, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3a,7a-dihydro-1H-benzimidazol-2-yl)-6-chlorochromen-4-one is sourced from PubChem (CID 118263591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).