C23H28N4O2 — CID 118263776
(3R,4R)-4-(cyclohexylamino)-1-[3-(1,3-oxazol-2-yl)quinolin-2-yl]piperidin-3-ol (PubChem CID 118263776) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is (3R,4R)-4-(cyclohexylamino)-1-[3-(1,3-oxazol-2-yl)quinolin-2-yl]piperidin-3-ol.
| Compound Name | (3R,4R)-4-(cyclohexylamino)-1-[3-(1,3-oxazol-2-yl)quinolin-2-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 118263776 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (3R,4R)-4-(cyclohexylamino)-1-[3-(1,3-oxazol-2-yl)quinolin-2-yl]piperidin-3-ol |
| SMILES | O[C@@H]1CN(c2nc3ccccc3cc2-c2ncco2)CC[C@H]1NC1CCCCC1 |
| InChI | InChI=1S/C23H28N4O2/c28-21-15-27(12-10-20(21)25-17-7-2-1-3-8-17)22-18(23-24-11-13-29-23)14-16-6-4-5-9-19(16)26-22/h4-6,9,11,13-14,17,20-21,25,28H,1-3,7-8,10,12,15H2/t20-,21-/m1/s1 |
| InChIKey | LFGUOMWNLGKCGQ-NHCUHLMSSA-N |
| XLogP | 3.75 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |