C26H29NO4S — CID 11826505
(2R)-1-(benzenesulfonyl)-N-benzyl-N-[[(2S)-oxiran-2-yl]methyl]-3-phenylmethoxypropan-2-amine (PubChem CID 11826505) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-N-benzyl-N-[[(2S)-oxiran-2-yl]methyl]-3-phenylmethoxypropan-2-amine.
| Compound Name | (2R)-1-(benzenesulfonyl)-N-benzyl-N-[[(2S)-oxiran-2-yl]methyl]-3-phenylmethoxypropan-2-amine |
|---|---|
| PubChem CID | 11826505 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-N-benzyl-N-[[(2S)-oxiran-2-yl]methyl]-3-phenylmethoxypropan-2-amine |
| SMILES | O=S(=O)(C[C@@H](COCc1ccccc1)N(Cc1ccccc1)C[C@H]1CO1)c1ccccc1 |
| InChI | InChI=1S/C26H29NO4S/c28-32(29,26-14-8-3-9-15-26)21-24(19-30-18-23-12-6-2-7-13-23)27(17-25-20-31-25)16-22-10-4-1-5-11-22/h1-15,24-25H,16-21H2/t24-,25+/m1/s1 |
| InChIKey | BHWWFXVIAYKXPU-RPBOFIJWSA-N |
| XLogP | 3.95 |
| TPSA | 59.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|